On Target OPRX_HUMAN 0.30569947/CHEMBL481707
For the given ligand lvkui, we have found in our database that, being scored 0.30569947, the most similar ligand is CHEMBL481707. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL481707 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CC1(CCCCCCC1)N2CCC(CC2)n3c(nc4ccccc34)c5oc6ccccc6c5 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00804002 01200c10 00180100 10010600 200c0260 0000e000 00000000 61280200 00204100 100019c0 0120802c 50218000 c0001402 01c40080 000200e0 020c0004 00104000 02003000 00602000 00400201 c0520000 38060078 21800001 00580014 08000000 c0000800 04000014 18000000 00002004 01460c10 c00a0820 04002280 |