On Target FYN_HUMAN 0.38947368/CHEMBL1990884
For the given ligand lvkui, we have found in our database that, being scored 0.38947368, the most similar ligand is CHEMBL1990884. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL1990884 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | Cc1cc(C)c2oc(Nc3ccc(cc3F)c4cccc(C(=O)N)c4N)nc2c1 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00002002 00000800 001a0318 02010608 10040205 04010050 00000480 00081200 02084320 00042850 00200024 5000a000 c0028c00 01609000 00020040 080c008c 00060400 52007000 0c200480 50a00000 44480000 0e028600 34c08800 04780004 00000000 80004800 08000150 180100c1 1000e008 01068800 c0144880 40000230 |