On Target CDK5_HUMAN 0.37313432/CHEMBL1989471
For the given ligand lvkui, we have found in our database that, being scored 0.37313432, the most similar ligand is CHEMBL1989471. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL1989471 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CC(C)c1ccc2C(=O)c3c(C)ccnc3Nc2c1 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00000002 00000800 00004100 40050200 00040000 00004060 00000000 00000000 02000100 40080840 09000004 40008000 80008800 00e00000 00000040 000c0004 00000000 0200c000 00200000 00200000 40000000 08008028 20800000 80500010 00002000 80000000 00000060 00040000 00000000 00420002 40040000 000004a0 |