On Target ESR1_HUMAN 0.35443038/CHEMBL187314
For the given ligand lvkui, we have found in our database that, being scored 0.35443038, the most similar ligand is CHEMBL187314. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL187314 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | Oc1ccc2nc(oc2c1)c3ccc4cc(O)ccc4c3 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00400002 00000008 20080100 10010200 00040220 00004000 02000400 00880200 00084120 10020850 00000004 4100a000 40010406 01600000 00020060 0204000c 00004000 42002840 08200280 40420000 40240000 08000028 22804000 04580000 00002000 80000000 04000014 18000000 00002004 01021400 40140840 00000000 |