On Target MIF_HUMAN 0.35151514/CHEMBL523238
For the given ligand lvkui, we have found in our database that, being scored 0.35151514, the most similar ligand is CHEMBL523238. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL523238 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | Cc1ccc2OC(=O)N(Cc3ccccc3)c2c1 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00000002 00000a00 00080100 00010600 00040210 00400000 00000400 80001600 04184020 000008f0 04000024 40c1a000 c0008c00 01600100 00100040 00040204 00040000 42804000 00200080 50000000 40000000 1a008010 20800018 a5780000 10000000 c0000000 20000170 18040010 06006000 03060008 00140000 00000020 |