On Target IKKB_HUMAN 0.42405063/CHEMBL1761509
For the given ligand lvkui, we have found in our database that, being scored 0.42405063, the most similar ligand is CHEMBL1761509. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL1761509 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | NC(=O)c1cc(cc2cc[nH]c12)c3oc4ccccc4c3 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00402002 00a00800 00080100 00050610 00041201 0c004000 00004000 40a01200 00004100 00000840 01000024 40108000 40008c00 004000c0 00000060 0804000c 00024000 02001804 04200200 00000002 c0640000 08028628 30800000 8048000c 08040000 80000000 0c000054 08000041 10406000 01060000 c0040240 80000000 |