On Target MK03_HUMAN 0.296875/CHEMBL1089119
For the given ligand lvkui, we have found in our database that, being scored 0.296875, the most similar ligand is CHEMBL1089119. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL1089119 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | FC(F)(F)c1ccc(Nc2ccnc3nc(ccc23)c4ncccc4C(F)(F)F)nc1 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 0000a002 00000801 00104180 10090210 00041020 30004000 00008c10 00080000 10002100 10000050 01708004 40008800 07000800 02f08000 a0020840 020c0004 00068020 12006004 0c20000a 10e00000 44000000 0c048028 30803800 80600120 00040002 80000000 0a0082c0 900100c0 0040c00c 00460c00 40140800 000002c0 |