On Target PERM_HUMAN 0.3255814/CHEMBL1630743
For the given ligand m6A, we have found in our database that, being scored 0.3255814, the most similar ligand is CHEMBL1630743. Check out the elaboration below.
| m6A (Given Ligand) | CHEMBL1630743 (Similar Ligand) |
|---|---|
| Cc4cc2cc1ccccc1cc2c(C3CCCCCCC3)c4C5CCCCCCC5 | NCCCCCCc1c[nH]c2ccc(F)cc12 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 00000000 02000000 00002000 00000001 00000100 08000008 01004000 00400010 00000000 80000001 00000000 00000000 00000002 00020002 00020000 00000400 | 00000002 01000800 00100102 42810610 00041100 00000030 00002000 00000000 00400800 000808c0 08100004 40018000 08000800 00601800 00000040 00040005 00000000 02000080 00202400 00100001 40000100 18008018 20800000 80400010 00042000 80000000 08000000 00000001 00000002 00078002 00060200 00000620 |