On Target TRPV3_HUMAN 0.2929293/CHEMBL3828278
For the given ligand m6A, we have found in our database that, being scored 0.2929293, the most similar ligand is CHEMBL3828278. Check out the elaboration below.
| m6A (Given Ligand) | CHEMBL3828278 (Similar Ligand) |
|---|---|
| Cc4cc2cc1ccccc1cc2c(C3CCCCCCC3)c4C5CCCCCCC5 | O[C@H](c1ccccn1)C2(CCC2)c3ccc(Cl)c(Cl)c3 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 00000000 02000000 00002000 00000001 00000100 08000008 01004000 00400010 00000000 80000001 00000000 00000000 00000002 00020002 00020000 00000400 | 0200800a 05000000 00004102 10010200 000c0060 00004000 05000000 00000000 00000b00 00080840 08108004 40808800 02000824 00200010 80860000 020c000c 08008000 06800000 00602008 00000001 40100100 08108120 21800002 00540010 00002800 80100000 00040040 00000080 00000006 00820002 40000000 20020500 |