On Target PDE4B_HUMAN 0.32608697/CHEMBL511115
For the given ligand m6A, we have found in our database that, being scored 0.32608697, the most similar ligand is CHEMBL511115. Check out the elaboration below.
| m6A (Given Ligand) | CHEMBL511115 (Similar Ligand) |
|---|---|
| Cc4cc2cc1ccccc1cc2c(C3CCCCCCC3)c4C5CCCCCCC5 | COc1ccc(cc1OC2CCCC2)[C@@]3(CC[C@H](CC3)C(=O)O)C#N |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 00000000 02000000 00002000 00000001 00000100 08000008 01004000 00400010 00000000 80000001 00000000 00000000 00000002 00020002 00020000 00000400 | 04010000 43000008 2000010a 00210700 00081000 42000000 02040000 00000000 00000800 00080840 08100000 40009000 0480c00a 20a00080 11000001 020ca00c 00c00000 02000000 02482000 00020201 00000100 18000a00 01800400 00400010 00000000 80000000 00120000 00000000 00000202 0106000a 04020000 000004c0 |