On Target NEP_HUMAN 0.46153846/CHEMBL4100250
For the given ligand m6A, we have found in our database that, being scored 0.46153846, the most similar ligand is CHEMBL4100250. Check out the elaboration below.
| m6A (Given Ligand) | CHEMBL4100250 (Similar Ligand) |
|---|---|
| Cc4cc2cc1ccccc1cc2c(C3CCCCCCC3)c4C5CCCCCCC5 | OC(=O)C(CC(=O)C(S)Cc1ccccc1)Cc2ccccc2 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 00000000 02000000 00002000 00000001 00000100 08000008 01004000 00400010 00000000 80000001 00000000 00000000 00000002 00020002 00020000 00000400 | 00050000 01000000 00000102 00110200 00080008 00000000 00000000 00000000 00a00800 01090840 08100000 40029000 04008008 00a40000 00000000 00080008 00000000 02000000 00402008 00000001 00000100 08000a00 01000140 02400010 00000800 80000000 00000000 00000040 00000002 00020002 00020000 01410400 |