On Target HPGDS_HUMAN 0.18627451/CHEMBL3907283
For the given ligand m6A, we have found in our database that, being scored 0.18627451, the most similar ligand is CHEMBL3907283. Check out the elaboration below.
| m6A (Given Ligand) | CHEMBL3907283 (Similar Ligand) |
|---|---|
| Cc4cc2cc1ccccc1cc2c(C3CCCCCCC3)c4C5CCCCCCC5 | C(c1ccccc1)c2ncc([nH]2)c3cnc(nc3)c4ccccc4 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 00000000 02000000 00002000 00000001 00000100 08000008 01004000 00400010 00000000 80000001 00000000 00000000 00000002 00020002 00020000 00000400 | 0001000a 00010000 00000500 10010610 00000060 00084000 00001000 00081000 00000100 10080850 08008004 40008810 02000080 00100000 00020001 000c0084 00008000 02002001 00400000 40400000 01000000 08008000 21802040 00440010 00840003 80000000 00000208 00001040 00030004 00660c02 40000820 30000480 |