On Target OPRK_HUMAN 0.516129/CHEMBL421038
For the given ligand m6A, we have found in our database that, being scored 0.516129, the most similar ligand is CHEMBL421038. Check out the elaboration below.
| m6A (Given Ligand) | CHEMBL421038 (Similar Ligand) |
|---|---|
| Cc4cc2cc1ccccc1cc2c(C3CCCCCCC3)c4C5CCCCCCC5 | CC[C@@H]1Cc2ccc(O)cc2C(C)(C)[C@@H]1N |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 00000000 02000000 00002000 00000001 00000100 08000008 01004000 00400010 00000000 80000001 00000000 00000000 00000002 00020002 00020000 00000400 | 00000000 43000208 20000102 00010600 00000020 c0000002 02000000 00000001 00000800 000808c0 08100000 40808000 00000002 00200000 00000020 02000008 00000200 02000000 00002000 00020201 00000100 18000000 00004000 81400010 00000000 80000001 00120000 00000000 04000002 0006000a 00000000 00000400 |