On Target AA1R_HUMAN 0.26984128/CHEMBL331504
For the given ligand m6A, we have found in our database that, being scored 0.26984128, the most similar ligand is CHEMBL331504. Check out the elaboration below.
| m6A (Given Ligand) | CHEMBL331504 (Similar Ligand) |
|---|---|
| Cc4cc2cc1ccccc1cc2c(C3CCCCCCC3)c4C5CCCCCCC5 | Cc1ccc(cc1)C(=O)c2c(N)sc3CCCCc23 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 00000000 02000000 00002000 00000001 00000100 08000008 01004000 00400010 00000000 80000001 00000000 00000000 00000002 00020002 00020000 00000400 | 10010002 01000800 00000902 c1010200 00100000 00098002 020005a0 01000001 00400900 00480a40 08300204 c0008a80 00008018 00201881 00023020 08080008 11000200 82000019 00102000 00004005 00400900 588a0ac0 21004008 10400014 0204c000 a4000011 00010000 40800104 02000082 00060002 88008000 20c10c10 |