On Target P2RX3_HUMAN 0.25396827/CHEMBL596234
For the given ligand m6A, we have found in our database that, being scored 0.25396827, the most similar ligand is CHEMBL596234. Check out the elaboration below.
| m6A (Given Ligand) | CHEMBL596234 (Similar Ligand) |
|---|---|
| Cc4cc2cc1ccccc1cc2c(C3CCCCCCC3)c4C5CCCCCCC5 | OC(=O)c1cc(C(=O)O)c(cc1C(=O)O)C(=O)N(Cc2cccc(Oc3ccccc3)c2)[C@H]4CCCc5ccccc45 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 00000000 02000000 00002000 00000001 00000100 08000008 01004000 00400010 00000000 80000001 00000000 00000000 00000002 00020002 00020000 00000400 | 00000008 45801808 2010010a 50050600 00001001 0000c000 12800080 2a001001 00100900 00080cc0 c8300000 40018800 80008882 00200000 01000481 08080008 00002200 02000000 00182000 40020201 80420100 18068fa0 00004000 0054801c 00000000 c0000c01 08004000 90200000 00000382 00860003 e0040400 00000600 |