On Target CXCR4_HUMAN 0.25384617/CHEMBL1644073
For the given ligand m6A, we have found in our database that, being scored 0.25384617, the most similar ligand is CHEMBL1644073. Check out the elaboration below.
| m6A (Given Ligand) | CHEMBL1644073 (Similar Ligand) |
|---|---|
| Cc4cc2cc1ccccc1cc2c(C3CCCCCCC3)c4C5CCCCCCC5 | NCc1ccc(CN(Cc2nc3ccccc3[nH]2)C4CCCc5cccnc45)c(CN)c1 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 00000000 02000000 00002000 00000001 00000100 08000008 01004000 00400010 00000000 80000001 00000000 00000000 00000002 00020002 00020000 00000400 | 0000001a 01004000 00104902 10810e10 00041161 00104000 01002000 22003003 00500900 000808c0 09318004 40818000 80000882 00600800 00020440 020c010c 00002200 06000006 00202c08 00000201 40120100 18018020 21804000 00500010 00140000 c0000001 08004040 90000080 00400106 00c60802 60040000 20004680 |