On Target FYN_HUMAN 0.39130434/CHEMBL1975923
For the given ligand m6A, we have found in our database that, being scored 0.39130434, the most similar ligand is CHEMBL1975923. Check out the elaboration below.
| m6A (Given Ligand) | CHEMBL1975923 (Similar Ligand) |
|---|---|
| Cc4cc2cc1ccccc1cc2c(C3CCCCCCC3)c4C5CCCCCCC5 | CC(CCC(=O)O)(c1ccc(O)c(N)c1)c2ccc(O)c(N)c2 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 00000000 02000000 00002000 00000001 00000100 08000008 01004000 00400010 00000000 80000001 00000000 00000000 00000002 00020002 00020000 00000400 | 08010002 01000008 20000102 00010200 00080000 00000000 02000000 01000000 00400800 00080840 08100004 40009000 04008002 00200800 00000040 00084008 00000000 02000000 00400000 00020001 40000100 08000a00 21000000 00400010 00040000 a0000000 00120000 40000000 00400080 00060002 00000000 00400400 |