On Target MIF_HUMAN 0.27522936/CHEMBL209588
For the given ligand m6A, we have found in our database that, being scored 0.27522936, the most similar ligand is CHEMBL209588. Check out the elaboration below.
| m6A (Given Ligand) | CHEMBL209588 (Similar Ligand) |
|---|---|
| Cc4cc2cc1ccccc1cc2c(C3CCCCCCC3)c4C5CCCCCCC5 | CC(C)(C)CC(=O)C[C@H]1CC(=NO1)c2ccc(O)c(F)c2 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 00000000 02000000 00002000 00000001 00000100 08000008 01004000 00400010 00000000 80000001 00000000 00000000 00000002 00020002 00020000 00000400 | 00010000 01000008 20900102 02050a00 02080000 10440010 02000040 00002400 08108948 00092841 08110000 50009000 9400880a 00a01000 00000008 00090018 00000800 02000000 00406000 00860401 00000100 28018200 01001042 00400010 00000000 80020004 e0120000 02000001 0010400a 00028002 400a0000 00000600 |