On Target PAR1_HUMAN 0.26143792/CHEMBL2012500
For the given ligand ascorbat, we have found in our database that, being scored 0.26143792, the most similar ligand is CHEMBL2012500. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL2012500 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CC[C@@H]1[C@@H](C)C[C@]2(O)[C@@H]([C@@H](C)OC2=O)[C@H]1\C=C\c3ccc(cn3)c4ccccc4 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00052042 81000000 00004300 90010710 000c1020 04000008 80000080 08000408 00000100 01108858 00000004 4000d000 04028808 00800000 010a0402 820c900c 00820400 0a000004 07602000 10002003 41000020 08108a00 35808020 08410010 01040401 82080000 08406240 c0008260 00404204 0006000a 24020020 00000000 |