On Target SC6A4_HUMAN 0.32330826/CHEMBL185169
For the given ligand ascorbat, we have found in our database that, being scored 0.32330826, the most similar ligand is CHEMBL185169. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL185169 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | COC(=O)C1=C(CC2CCC1O2)c3ccc4ccccc4c3 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00050040 01000008 00000b02 00010300 000c0040 00200800 82000280 28000402 01800800 01180848 48100200 40009000 14028008 00a00000 00080406 00081008 00820400 02000000 2141a018 00008001 20000120 18001a88 0100a060 00400010 01201480 80000400 00406000 c0000400 00400202 00020002 24020000 00000410 |