On Target TRPV3_HUMAN 0.13294798/CHEMBL3664218
For the given ligand ascorbat, we have found in our database that, being scored 0.13294798, the most similar ligand is CHEMBL3664218. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL3664218 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | COc1cccc(CNC(=O)CC2CC3(CCC3)Oc4ccc(Cl)cc24)c1OC5CCCC5 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 04018000 45800218 2010010a 00210700 00081000 82000100 06000000 22001600 00000800 001808c0 08300000 40019840 0680c82e 01200010 91000601 020ca008 00800000 22008400 00482008 00020201 80000140 18008710 01000040 00548418 00002800 c0000000 00100000 90000000 00000302 0106c00b 24060000 00020640 |