On Target AMPN_HUMAN 0.18181819/CHEMBL3298946
For the given ligand ascorbat, we have found in our database that, being scored 0.18181819, the most similar ligand is CHEMBL3298946. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL3298946 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CCOCC[C@H]([NH3+])CS.[O-]C(=O)C(F)(F)F |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00000000 00000000 00100000 00110500 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40088000 00008000 040c0000 00000000 00081008 00200000 00000000 00c00000 00000005 00000020 10000a00 01000100 00400010 00000400 00000000 00000000 90000000 00000200 00040000 00000000 03010200 |