On Target AOFA_HUMAN 0.2519084/CHEMBL123768
For the given ligand ascorbat, we have found in our database that, being scored 0.2519084, the most similar ligand is CHEMBL123768. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL123768 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CCOC(=O)C1=Cc2cc(C)ccc2CC1=O |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 10090000 01000000 00000302 00110300 200c0001 00200000 82000080 00000400 01800900 00180842 48102000 40009800 15028000 00200000 40000022 0008100a 00820400 02000000 20418018 00000001 00100120 08000a00 0100c020 00400010 01001400 80000101 00402000 c0000400 00404200 00220002 04002020 00410410 |