On Target ADRB2_HUMAN 0.2265625/CHEMBL1569630
For the given ligand ascorbat, we have found in our database that, being scored 0.2265625, the most similar ligand is CHEMBL1569630. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL1569630 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CC(=CCC(C)(C)C1OCCN1C(=O)c2ccccc2)C |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00000008 80405800 00100100 80010700 00000080 00000000 00020000 22001400 10000200 001008c0 00200000 40008000 00028802 00000000 00081408 001a1008 10004000 02000000 00400800 00002201 00000020 18068610 13008000 0040003c 10000400 c0000002 10c00000 90200001 04000300 00060001 a4040000 00000200 |