On Target CHLE_HUMAN 0.31851852/CHEMBL492233
For the given ligand ascorbat, we have found in our database that, being scored 0.31851852, the most similar ligand is CHEMBL492233. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL492233 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | O=C(NCc1ccccc1)O[C@H]2CO[C@@H]3[C@@H](CO[C@H]23)OC(=O)\C=C\c4ccccc4 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00040040 01c00801 00000508 80010700 002800c0 00000000 82000080 82001440 01802200 01000840 40200000 40008010 0c008800 02800100 00080002 001a9008 00820400 02000000 3141a818 00000001 80000020 18008e10 05000000 0840001c 00001400 80001002 00402000 c0200460 00400300 0006000b 84040000 00000210 |