On Target TNFA_HUMAN 0.19526628/CHEMBL3983488
For the given ligand ascorbat, we have found in our database that, being scored 0.19526628, the most similar ligand is CHEMBL3983488. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL3983488 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CCCCCCCCCCCCCCO[C@H]1[C@@H](OC)O[C@H](COC(=O)CCC(=O)OC[C@H](NC(=O)OCC2c3ccccc3c4ccccc24)C(=O)O)[C@@H](OC)[C@@H]1OCCCCCCCCCCCCCC |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00042040 01404001 00000708 80810700 802c00c0 00220000 00002c00 01000040 00202200 01081860 08200000 4000b000 1c008000 02a00100 20041008 003a9008 08860000 02000100 1540a810 01000001 00100020 38000e10 17004010 08400018 10800400 a0041002 00808800 64200060 02004282 0006080b a0a24000 00000600 |