On Target BACE1_HUMAN 0.26865673/CHEMBL4085945
For the given ligand ascorbat, we have found in our database that, being scored 0.26865673, the most similar ligand is CHEMBL4085945. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL4085945 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CC(=CCC\C(=C\CC\C(=C\CCC1(C)Oc2c(C)cc(O)cc2C=C1)\C)\C(=O)O)C |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 04010000 c1000028 20000308 80010300 00291001 02000000 82000080 08000402 05000004 00108848 40000000 40509000 06828002 00000000 11000403 00082008 00000400 22008000 1041001c 00022201 00040000 08000a80 01008020 00400010 01201000 80000400 00486200 c0000400 00404300 80220100 04000000 02000010 |