On Target NOS1_HUMAN 0.1440678/CHEMBL298404
For the given ligand ascorbat, we have found in our database that, being scored 0.1440678, the most similar ligand is CHEMBL298404. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL298404 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | NC(Cc1ccccc1N=C(N)N)C(=O)O |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00000002 00000000 00000100 00010e00 00000000 00000000 02002000 00000000 00000800 00080842 08100004 4000b000 04009000 40000008 000200c0 00080008 00000800 02000000 01400018 00000001 40000100 18010a00 23000040 81400010 00080800 88000000 40800000 00000800 04000000 00860002 00080000 20000500 |