On Target NK1R_HUMAN 0.21527778/CHEMBL435564
For the given ligand ascorbat, we have found in our database that, being scored 0.21527778, the most similar ligand is CHEMBL435564. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL435564 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | Cc1cc(C)cc(COC2C3CCN(CC3)/C/2=C/c4ccccc4)c1 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00400000 01000000 00100b00 80010700 00100091 00004000 820002a0 20000400 00000500 001008c0 40201200 50018000 04020002 00010000 0008140a 02081048 10000400 12004000 20410018 50000201 00000020 38000020 13008020 00500010 05001400 80002000 00486200 d0040521 00400200 00060000 44000004 02000a10 |