On Target OPRK_HUMAN 0.3898305/CHEMBL1773748
For the given ligand ascorbat, we have found in our database that, being scored 0.3898305, the most similar ligand is CHEMBL1773748. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL1773748 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | COC(=O)[C@@H]1C[C@H](OC(=O)C)C(=O)[C@H]2[C@@]1(C)CC[C@H]3C(=O)O[C@@H](C[C@]23C)C4=CC5OC4C(=C5C(=O)OC)C(=O)OC |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00050042 81000000 00000100 80090380 803c0040 00200800 02000080 0a000402 01000000 01120000 40000000 4000d001 14028028 02800000 00000400 00081008 00820010 80000100 33612010 02022001 00000021 10000a80 01008000 00000814 00201400 00001400 00404000 80000000 00000202 8000000a 24020000 02800010 |