On Target AA1R_HUMAN 0.19277108/CHEMBL217076
For the given ligand ascorbat, we have found in our database that, being scored 0.19277108, the most similar ligand is CHEMBL217076. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL217076 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CCCN1C(=O)N(CCC)c2[nH]c(nc2C1=O)[C@@]34CC[C@@](CC3)(CC4)\C=C\C(=O)O |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 0000002a 01801800 00180400 12010700 04080060 0000c440 01009080 08000400 17400100 801010a0 0c00800c 40810800 00029000 00d00000 002a0480 080c100c 00800000 04008000 02412018 00000001 80100500 10000ad0 21808041 00300014 00041000 c0200600 60404000 90040080 00004005 00c60800 e40a0000 60000288 |