On Target AOFB_HUMAN 0.25903615/CHEMBL4062286
For the given ligand ascorbat, we have found in our database that, being scored 0.25903615, the most similar ligand is CHEMBL4062286. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL4062286 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | COc1c(OC\C=C(/C)\C[C@H]2OC(=O)C(=C2)CCC(=O)N)ccc3C=CC(=O)Oc13 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 0c050040 01200028 20080108 00210700 001d1214 00400820 02000080 68000602 130a4000 401208c0 40000200 40419000 4682c432 01200080 01000485 02089009 00820010 00000040 08410010 02028003 00040020 18001e88 0120a008 00180010 08601500 00000400 00406011 88100000 06042200 8106080a 04000000 00800010 |