On Target PGH1_SHEEP 0.43220338/CHEMBL502799
For the given ligand ascorbat, we have found in our database that, being scored 0.43220338, the most similar ligand is CHEMBL502799. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL502799 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CC(C)[C@@H](N(C)C)C(=O)O[C@@H]1[C@@H](C)[C@@]2(O)[C@@H](C=C(CO)C[C@]3(O)[C@H]2C=C(C)C3=O)[C@@H]4C(C)(C)[C@]14OC(=O)C |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00050040 81000000 00100d08 80010700 002800c0 00000000 00000280 28000442 01002000 01100008 00200200 4000f000 04028028 03800000 0000140c 00099008 00820000 00000000 13412010 02002001 00000020 10000a80 17008000 08000010 10201480 00200400 00404200 80001020 00000200 8004000a 24024000 00000200 |