On Target NMDE2_HUMAN 0.14184397/CHEMBL218546
For the given ligand ascorbat, we have found in our database that, being scored 0.14184397, the most similar ligand is CHEMBL218546. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL218546 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | O=C(OCc1ccccc1)N2CCC(Cc3nc4ccccc4[nH]3)CC2 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 0100000a 01401000 00100500 10010600 00040060 0000c000 01000000 20000000 00000300 000008c0 01208004 50818000 00008002 00410000 00020040 021e000c 00020000 06080400 00200888 00000201 40200000 18040c70 21800000 00500018 00000000 80002002 00000000 10200080 00000204 00c60801 c0000000 20000280 |