On Target GRM5_HUMAN 0.18243243/CHEMBL3086720
For the given ligand ascorbat, we have found in our database that, being scored 0.18243243, the most similar ligand is CHEMBL3086720. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL3086720 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | COC(=O)N1CCC2(CC1)CC(O)(CO2)C#Cc3cccc(C)c3 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00000240 01025000 00100902 00090700 00482001 00008000 00200000 20000000 00000200 010008c0 00240080 5001c008 00008082 01881000 00080000 001b9008 00220200 82080000 01c02000 00000201 00000028 19940d50 05000881 0a500019 00000405 8004000a 00000000 10000020 00000208 00064201 80000804 00000200 |