On Target AGTR2_HUMAN 0.16666667/CHEMBL1668009
For the given ligand ascorbat, we have found in our database that, being scored 0.16666667, the most similar ligand is CHEMBL1668009. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL1668009 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CCCCc1nc(Cl)c2C(=CCC(c3ccc(cc3)c4ccccc4c5nnn[nH]5)n12)C(=O)O |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 0001a04a 05800219 40501500 13110610 040800c4 0c0a0008 810823a4 38181500 91600904 181838da 28108008 40019a00 86029888 00b00002 a10b0082 000c204c 10028000 0e400840 24490018 50010003 84060500 18008b80 31208060 81414410 01045000 c2200700 90440001 900096c0 84084004 00c6080a c40c7284 28030402 |