On Target SCN9A_HUMAN 0.17032968/CHEMBL3942132
For the given ligand ascorbat, we have found in our database that, being scored 0.17032968, the most similar ligand is CHEMBL3942132. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL3942132 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CCOC(=O)[C@H](O)[C@H](O)c1cccc(n1)c2ccc(Oc3ccc(c(c3)C#N)C(F)(F)F)cc2 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 0000200a 40000008 20105108 10010300 000410e1 00004000 02040400 00080140 00000b00 11880850 08108004 5081d020 14008832 01200000 01060001 020c100c 08428000 06802000 05e82018 00420201 44400120 08008a20 358004c2 08400010 00000c00 82000000 08220448 90201060 00004284 00a21402 40100c80 20000600 |