On Target PRGR_HUMAN 0.42696628/CHEMBL3695598
For the given ligand ascorbat, we have found in our database that, being scored 0.42696628, the most similar ligand is CHEMBL3695598. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL3695598 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | C[C@@H]1CC2=CC(=O)CC[C@@H]2[C@H]3CC[C@@]4(C)[C@@H](CC[C@]45OC(=O)C=C5)[C@H]13 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00050000 01000000 00000100 00010300 00080000 00000000 02000080 08000402 01000000 00108000 00000000 40009000 04028008 00800000 00000400 00081008 00820010 00000020 02412010 00000001 00000020 00000a80 01008000 00000010 00201400 00000400 00404000 80000000 00000200 01000002 24020000 00800010 |