On Target DRD4_HUMAN 0.216/CHEMBL2112284
For the given ligand ascorbat, we have found in our database that, being scored 0.216, the most similar ligand is CHEMBL2112284. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL2112284 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CC1(CCN(Cc2ccccc2)CC1)C(=O)\C=C(/O)\c3ccc(Cl)cc3 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00028000 01000000 00100300 00010600 00000000 00004000 80000080 22001400 01800100 001208c0 00200000 50019800 86028886 00000000 00000402 00080008 00000400 02000000 00058000 00000201 00000000 18008320 00008020 00500010 01002000 c0000000 00446000 d0000000 00404100 00060000 64040000 00820200 |