On Target ACE_HUMAN 0.24038461/CHEMBL80667
For the given ligand ascorbat, we have found in our database that, being scored 0.24038461, the most similar ligand is CHEMBL80667. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL80667 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | OC(=O)C(Cc1ccccc1)OC(=O)CCS |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00000040 00000000 00000500 00110200 00000040 00000000 00000000 00000040 00000800 00080840 08100000 4000d000 04008000 00040000 00040000 08088008 08420000 82000000 04400008 00400001 00010120 08000a00 05000440 08400014 00000c00 80000000 00000000 00000020 00000200 00020002 00000000 03010480 |