On Target CXCR4_HUMAN 0.22748815/CHEMBL1221944
For the given ligand ascorbat, we have found in our database that, being scored 0.22748815, the most similar ligand is CHEMBL1221944. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL1221944 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | C[C@H](OC(=O)C)\C=C/C(=O)N[C@@H]1C[C@H](C)[C@H](C\C=C(/C)\C=C\[C@H]2O[C@@](C)(C[C@@]3(CO3)[C@@H]2O)OCCNC(=O)CCCCCNC(=O)CCCCCNC(=O)CCCC[C@@H]4SC[C@@H]5NC(=O)N[C@H]45)O[C@@H]1C |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00050050 c704f000 20100800 80910f40 c03801c0 00800801 02103804 28002402 05200000 031040e8 40200200 c0079000 0403910e 02870100 0008140c 0028900c 34821040 00002100 3141a0f0 0000a301 c0102120 30051e90 1740a300 0830001a 10211400 00008c00 00c84200 b4000021 08000242 00040021 24aa0000 07812a10 |