On Target MTOR_HUMAN 0.38235295/CHEMBL1911631
For the given ligand ascorbat, we have found in our database that, being scored 0.38235295, the most similar ligand is CHEMBL1911631. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL1911631 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CCCCC\C=C\C=C\[C@]12O[C@@H]3[C@@H]4[C@@H]5O[C@]5(CO)[C@@H](O)[C@@]6(O)[C@@H](C=C(C)C6=O)[C@@]4(O1)[C@H](C)[C@@H](OC(=O)C)[C@@]3(O2)C(=C)C |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00050040 81040000 00000d08 00810300 402800c0 00800005 02802a80 08000442 01202000 01100028 40000200 4000d000 1c028028 02820000 00000404 0028900c 00820000 00000100 3341a090 0200a001 00100020 10001a80 0540a000 08000012 00201400 00200000 00406002 a4011020 00000242 8000000a 24a20000 00000010 |