On Target CAH2_HUMAN 0.368/CHEMBL3609432
For the given ligand ascorbat, we have found in our database that, being scored 0.368, the most similar ligand is CHEMBL3609432. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL3609432 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CC(=O)OC[C@H]1OC(NS(=O)(=O)ON)C=C[C@@H]1OC(=O)C |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00000010 80400000 00001508 85650f00 00100040 00000021 02000000 08000440 00002000 01500000 40002201 40008011 08028000 00000103 00000004 00191118 20020000 00000100 21400010 0000f103 20013021 10000a00 05028000 08000810 00001400 00001c02 00400004 80000062 00000200 0004000a 04000000 00810070 |