On Target ESR1_HUMAN 0.2905983/CHEMBL4089824
For the given ligand ascorbat, we have found in our database that, being scored 0.2905983, the most similar ligand is CHEMBL4089824. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL4089824 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | OCCCCOC(=O)\C=C\c1ccc(cc1)C(=C2C3CC4CC(CC2C4)C3)c5ccc(O)cc5 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00040000 01000008 20000300 00010300 00200000 00000000 82000080 01000400 01800100 00180840 48000000 40008800 04028002 00000000 00000402 00081008 00020400 02000000 3241a018 00020001 01000020 08000a00 01008021 00400010 01001400 a0000000 00526000 c0000400 00400280 00020002 24020000 00000410 |