On Target MIF_HUMAN 0.3026316/CHEMBL2375653
For the given ligand ascorbat, we have found in our database that, being scored 0.3026316, the most similar ligand is CHEMBL2375653. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL2375653 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | C[C@H]1C[C@]23OC(=O)\C(=C/4\OC\C(=C/[C@H](O)C\C=C\C(=C\[C@@]2(C)C=C1C)\C)\C=C4)\C3=O |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 0005044a 81040000 00000900 90010301 400d0001 00200801 02000100 08011402 01000100 00108040 48000200 4040d091 94028008 20824000 02080405 0008100c 00820004 80000020 204d6090 0202a001 20002021 00005a00 0140a000 00000816 00201400 80001400 00407200 80000000 00004242 80000002 3682a000 06000010 |