On Target IKKB_HUMAN 0.37254903/CHEMBL1253688
For the given ligand ascorbat, we have found in our database that, being scored 0.37254903, the most similar ligand is CHEMBL1253688. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL1253688 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | O=C(CCc1ccccc1)\C=C\C[C@@H]2CC=CC(=O)O2 |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 00040000 01000000 00000902 00010200 00000000 00000000 02000280 08000402 01000800 00180840 48100200 40009000 04028000 00200000 00000404 00080008 00020000 02000000 20010018 00008001 20000120 08001a80 0100a000 00400010 00201c00 80002400 00406200 80000000 00000200 00020002 04000000 00000410 |