On Target MK03_HUMAN 0.25120774/CHEMBL555017
For the given ligand ascorbat, we have found in our database that, being scored 0.25120774, the most similar ligand is CHEMBL555017. Check out the elaboration below.
| ascorbat (Given Ligand) | CHEMBL555017 (Similar Ligand) |
|---|---|
| O=C1OC(C(O)CO)/C(O)=C1/[O-] | CC(=CCC[C@@]1(C)Oc2c(CC=C(C)C)c3O[C@@]45[C@H]6C[C@@H](C=C4C(=O)c3c(O)c2C=C1)C(=O)[C@]5(C\C=C(\C)/C(=O)O)OC6(C)C)C |
|
|
|
|
|
|
| 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 | 04050041 81000838 22800b0b 80210302 00281041 82a20800 c22402c1 28000642 05042854 019a0a48 48140200 4000d060 1682802a 00a00000 11280407 0808b008 00800400 a2108124 1361201e 0202a801 00040120 18021a80 0500a061 0a400014 01201400 c0000400 00526a08 c0800420 00414302 80234002 a4020000 00000410 |