On Target TRPV1_RAT 0.4397163/CHEMBL195789
For the given ligand A26, we have found in our database that, being scored 0.4397163, the most similar ligand is CHEMBL195789. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL195789 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | CC(C)(C)c1ccc(\C=C\C(=O)Nc2ccc3OCCOc3c2)cc1 |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 04004202 80008008 20000108 00210600 10001000 04000000 82000280 00000408 01802100 00480840 08280004 60008808 0080c022 08110000 01200043 00088008 20040480 02000100 08018002 00822400 41100000 08000600 24002000 08400010 00000000 80000000 00442000 40810080 00408200 0006000b 04000000 00020600 |