On Target HYES_HUMAN 0.42647058/CHEMBL4060303
For the given ligand A26, we have found in our database that, being scored 0.42647058, the most similar ligand is CHEMBL4060303. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL4060303 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | CC(=C\C=C/1\C(=O)Nc2ccccc12)C |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00004202 00048000 00100100 00010600 20000000 04000001 80000080 00020400 01000000 00080840 082c0004 60009008 01008000 20110000 40020142 00000000 20040400 02000100 08090080 00000000 40100010 18200600 60022000 81400011 08000000 82000200 00402010 40001280 04408000 080e0003 04002000 21000600 |