On Target AOFA_HUMAN 0.45112783/CHEMBL466872
For the given ligand A26, we have found in our database that, being scored 0.45112783, the most similar ligand is CHEMBL466872. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL466872 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | O=C1Nc2ccc(\C=C\c3ccccc3)cc2C1=O |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00004002 00000800 00100100 00010600 20001001 00010000 80200080 00080400 04800000 00080840 08280104 4000b000 01008000 00108000 40020142 08080008 00040400 02000000 08000000 00000000 40100000 18220600 20002000 81400015 00000000 80000280 00402018 40005080 0440c000 00260003 84007000 20002600 |